Website Structure

This commit is contained in:
supalerk-ar66 2026-01-13 10:46:40 +07:00
parent 62812f2090
commit 71f0676a62
22365 changed files with 4265753 additions and 791 deletions

124
Frontend-Learner/node_modules/koa-static/History.md generated vendored Normal file
View file

@ -0,0 +1,124 @@
5.0.0 / 2018-06-19
==================
* bump deps
4.0.3 / 2018-05-17
==================
* npm: disable package-lock
* bump deps
4.0.2 / 2017-11-16
==================
* Fix: `serve` mutates `opts` argument so it cannot be reused (#117)
4.0.1 / 2017-07-09
==================
* Fix: throw error if error status not 404
* fix `index: false` bug if path is directory
4.0.0 / 2017-07-03
==================
* upgrade to koa-send@4
* use async function
3.0.0 / 2016-03-24
==================
* support koa 2.x
* travis: test node@4+
2.0.0 / 2016-01-07
==================
* bump koa-send@~3.1.0
1.5.2 / 2015-11-03
==================
* Fix: default index could be disabled. Closes #41
1.5.1 / 2015-10-14
==================
* Fix v1.4.x → 1.5.0 broken. Closes #53
1.5.0 / 2015-10-14
==================
* update koa-send@2
* update devDeps
1.4.9 / 2015-02-03
==================
* only support GET and HEAD requests
1.4.8 / 2014-12-17
==================
* support root = `.`
1.4.7 / 2014-09-07
==================
* update koa-send
1.4.5 / 2014-05-05
==================
* Fix response already handled logic - Koajs now defaults status == 404. See koajs/koa#269
1.4.4 / 2014-05-04
==================
* Add two missing semicolons. Closes #24
* Use bash syntax highlighting for install command. Closes #23
* named generator function to help debugging. Closes #20
1.4.3 / 2014-02-11
==================
* update koa-send
1.4.2 / 2014-01-07
==================
* update koa-send
1.4.1 / 2013-12-30
==================
* fix for koa 0.2.1. Closes #12
1.4.0 / 2013-12-20
==================
* add: defer option - semi-breaking change
1.3.0 / 2013-12-11
==================
* refactor to use koa-send
* rename maxAge -> maxage
* fix: don't bother responding if response already "handled"
1.2.0 / 2013-09-14
==================
* add Last-Modified. Closes #5
1.1.1 / 2013-09-13
==================
* fix upstream responses
1.1.0 / 2013-09-13
==================
* rewrite without send

86
Frontend-Learner/node_modules/koa-static/Readme.md generated vendored Normal file
View file

@ -0,0 +1,86 @@
# koa-static
[![NPM version][npm-image]][npm-url]
[![Build status][travis-image]][travis-url]
[![Test coverage][coveralls-image]][coveralls-url]
[![Dependency Status][david-image]][david-url]
[![License][license-image]][license-url]
[![Downloads][downloads-image]][downloads-url]
Koa static file serving middleware, wrapper for [`koa-send`](https://github.com/koajs/send).
## Installation
```bash
$ npm install koa-static
```
## API
```js
const Koa = require('koa');
const app = new Koa();
app.use(require('koa-static')(root, opts));
```
* `root` root directory string. nothing above this root directory can be served
* `opts` options object.
### Options
- `maxage` Browser cache max-age in milliseconds. defaults to 0
- `hidden` Allow transfer of hidden files. defaults to false
- `index` Default file name, defaults to 'index.html'
- `defer` If true, serves after `return next()`, allowing any downstream middleware to respond first.
- `gzip` Try to serve the gzipped version of a file automatically when gzip is supported by a client and if the requested file with .gz extension exists. defaults to true.
- `br` Try to serve the brotli version of a file automatically when brotli is supported by a client and if the requested file with .br extension exists (note, that brotli is only accepted over https). defaults to true.
- [setHeaders](https://github.com/koajs/send#setheaders) Function to set custom headers on response.
- `extensions` Try to match extensions from passed array to search for file when no extension is sufficed in URL. First found is served. (defaults to `false`)
## Example
```js
const serve = require('koa-static');
const Koa = require('koa');
const app = new Koa();
// $ GET /package.json
app.use(serve('.'));
// $ GET /hello.txt
app.use(serve('test/fixtures'));
// or use absolute paths
app.use(serve(__dirname + '/test/fixtures'));
app.listen(3000);
console.log('listening on port 3000');
```
### See also
- [koajs/conditional-get](https://github.com/koajs/conditional-get) Conditional GET support for koa
- [koajs/compress](https://github.com/koajs/compress) Compress middleware for koa
- [koajs/mount](https://github.com/koajs/mount) Mount `koa-static` to a specific path
## License
MIT
[npm-image]: https://img.shields.io/npm/v/koa-static.svg?style=flat-square
[npm-url]: https://npmjs.org/package/koa-static
[github-tag]: http://img.shields.io/github/tag/koajs/static.svg?style=flat-square
[github-url]: https://github.com/koajs/static/tags
[travis-image]: https://img.shields.io/travis/koajs/static.svg?style=flat-square
[travis-url]: https://travis-ci.org/koajs/static
[coveralls-image]: https://img.shields.io/coveralls/koajs/static.svg?style=flat-square
[coveralls-url]: https://coveralls.io/r/koajs/static?branch=master
[david-image]: http://img.shields.io/david/koajs/static.svg?style=flat-square
[david-url]: https://david-dm.org/koajs/static
[license-image]: http://img.shields.io/npm/l/koa-static.svg?style=flat-square
[license-url]: LICENSE
[downloads-image]: http://img.shields.io/npm/dm/koa-static.svg?style=flat-square
[downloads-url]: https://npmjs.org/package/koa-static
[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square
[gittip-url]: https://www.gittip.com/jonathanong/

73
Frontend-Learner/node_modules/koa-static/index.js generated vendored Normal file
View file

@ -0,0 +1,73 @@
'use strict'
/**
* Module dependencies.
*/
const debug = require('debug')('koa-static')
const { resolve } = require('path')
const assert = require('assert')
const send = require('koa-send')
/**
* Expose `serve()`.
*/
module.exports = serve
/**
* Serve static files from `root`.
*
* @param {String} root
* @param {Object} [opts]
* @return {Function}
* @api public
*/
function serve (root, opts) {
opts = Object.assign({}, opts)
assert(root, 'root directory is required to serve files')
// options
debug('static "%s" %j', root, opts)
opts.root = resolve(root)
if (opts.index !== false) opts.index = opts.index || 'index.html'
if (!opts.defer) {
return async function serve (ctx, next) {
let done = false
if (ctx.method === 'HEAD' || ctx.method === 'GET') {
try {
done = await send(ctx, ctx.path, opts)
} catch (err) {
if (err.status !== 404) {
throw err
}
}
}
if (!done) {
await next()
}
}
}
return async function serve (ctx, next) {
await next()
if (ctx.method !== 'HEAD' && ctx.method !== 'GET') return
// response is already handled
if (ctx.body != null || ctx.status !== 404) return // eslint-disable-line
try {
await send(ctx, ctx.path, opts)
} catch (err) {
if (err.status !== 404) {
throw err
}
}
}
}

View file

@ -0,0 +1,395 @@
3.1.0 / 2017-09-26
==================
* Add `DEBUG_HIDE_DATE` env var (#486)
* Remove ReDoS regexp in %o formatter (#504)
* Remove "component" from package.json
* Remove `component.json`
* Ignore package-lock.json
* Examples: fix colors printout
* Fix: browser detection
* Fix: spelling mistake (#496, @EdwardBetts)
3.0.1 / 2017-08-24
==================
* Fix: Disable colors in Edge and Internet Explorer (#489)
3.0.0 / 2017-08-08
==================
* Breaking: Remove DEBUG_FD (#406)
* Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418)
* Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408)
* Addition: document `enabled` flag (#465)
* Addition: add 256 colors mode (#481)
* Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440)
* Update: component: update "ms" to v2.0.0
* Update: separate the Node and Browser tests in Travis-CI
* Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots
* Update: separate Node.js and web browser examples for organization
* Update: update "browserify" to v14.4.0
* Fix: fix Readme typo (#473)
2.6.9 / 2017-09-22
==================
* remove ReDoS regexp in %o formatter (#504)
2.6.8 / 2017-05-18
==================
* Fix: Check for undefined on browser globals (#462, @marbemac)
2.6.7 / 2017-05-16
==================
* Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
* Fix: Inline extend function in node implementation (#452, @dougwilson)
* Docs: Fix typo (#455, @msasad)
2.6.5 / 2017-04-27
==================
* Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
* Misc: clean up browser reference checks (#447, @thebigredgeek)
* Misc: add npm-debug.log to .gitignore (@thebigredgeek)
2.6.4 / 2017-04-20
==================
* Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
* Chore: ignore bower.json in npm installations. (#437, @joaovieira)
* Misc: update "ms" to v0.7.3 (@tootallnate)
2.6.3 / 2017-03-13
==================
* Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
* Docs: Changelog fix (@thebigredgeek)
2.6.2 / 2017-03-10
==================
* Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
* Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
* Docs: Add Slackin invite badge (@tootallnate)
2.6.1 / 2017-02-10
==================
* Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
* Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
* Fix: IE8 "Expected identifier" error (#414, @vgoma)
* Fix: Namespaces would not disable once enabled (#409, @musikov)
2.6.0 / 2016-12-28
==================
* Fix: added better null pointer checks for browser useColors (@thebigredgeek)
* Improvement: removed explicit `window.debug` export (#404, @tootallnate)
* Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
2.5.2 / 2016-12-25
==================
* Fix: reference error on window within webworkers (#393, @KlausTrainer)
* Docs: fixed README typo (#391, @lurch)
* Docs: added notice about v3 api discussion (@thebigredgeek)
2.5.1 / 2016-12-20
==================
* Fix: babel-core compatibility
2.5.0 / 2016-12-20
==================
* Fix: wrong reference in bower file (@thebigredgeek)
* Fix: webworker compatibility (@thebigredgeek)
* Fix: output formatting issue (#388, @kribblo)
* Fix: babel-loader compatibility (#383, @escwald)
* Misc: removed built asset from repo and publications (@thebigredgeek)
* Misc: moved source files to /src (#378, @yamikuronue)
* Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
* Test: coveralls integration (#378, @yamikuronue)
* Docs: simplified language in the opening paragraph (#373, @yamikuronue)
2.4.5 / 2016-12-17
==================
* Fix: `navigator` undefined in Rhino (#376, @jochenberger)
* Fix: custom log function (#379, @hsiliev)
* Improvement: bit of cleanup + linting fixes (@thebigredgeek)
* Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
* Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
2.4.4 / 2016-12-14
==================
* Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
2.4.3 / 2016-12-14
==================
* Fix: navigation.userAgent error for react native (#364, @escwald)
2.4.2 / 2016-12-14
==================
* Fix: browser colors (#367, @tootallnate)
* Misc: travis ci integration (@thebigredgeek)
* Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
2.4.1 / 2016-12-13
==================
* Fix: typo that broke the package (#356)
2.4.0 / 2016-12-13
==================
* Fix: bower.json references unbuilt src entry point (#342, @justmatt)
* Fix: revert "handle regex special characters" (@tootallnate)
* Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
* Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
* Improvement: allow colors in workers (#335, @botverse)
* Improvement: use same color for same namespace. (#338, @lchenay)
2.3.3 / 2016-11-09
==================
* Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
* Fix: Returning `localStorage` saved values (#331, Levi Thomason)
* Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
2.3.2 / 2016-11-09
==================
* Fix: be super-safe in index.js as well (@TooTallNate)
* Fix: should check whether process exists (Tom Newby)
2.3.1 / 2016-11-09
==================
* Fix: Added electron compatibility (#324, @paulcbetts)
* Improvement: Added performance optimizations (@tootallnate)
* Readme: Corrected PowerShell environment variable example (#252, @gimre)
* Misc: Removed yarn lock file from source control (#321, @fengmk2)
2.3.0 / 2016-11-07
==================
* Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
* Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
* Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
* Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
* Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
* Package: Update "ms" to 0.7.2 (#315, @DevSide)
* Package: removed superfluous version property from bower.json (#207 @kkirsche)
* Readme: fix USE_COLORS to DEBUG_COLORS
* Readme: Doc fixes for format string sugar (#269, @mlucool)
* Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
* Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
* Readme: better docs for browser support (#224, @matthewmueller)
* Tooling: Added yarn integration for development (#317, @thebigredgeek)
* Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
* Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
* Misc: Updated contributors (@thebigredgeek)
2.2.0 / 2015-05-09
==================
* package: update "ms" to v0.7.1 (#202, @dougwilson)
* README: add logging to file example (#193, @DanielOchoa)
* README: fixed a typo (#191, @amir-s)
* browser: expose `storage` (#190, @stephenmathieson)
* Makefile: add a `distclean` target (#189, @stephenmathieson)
2.1.3 / 2015-03-13
==================
* Updated stdout/stderr example (#186)
* Updated example/stdout.js to match debug current behaviour
* Renamed example/stderr.js to stdout.js
* Update Readme.md (#184)
* replace high intensity foreground color for bold (#182, #183)
2.1.2 / 2015-03-01
==================
* dist: recompile
* update "ms" to v0.7.0
* package: update "browserify" to v9.0.3
* component: fix "ms.js" repo location
* changed bower package name
* updated documentation about using debug in a browser
* fix: security error on safari (#167, #168, @yields)
2.1.1 / 2014-12-29
==================
* browser: use `typeof` to check for `console` existence
* browser: check for `console.log` truthiness (fix IE 8/9)
* browser: add support for Chrome apps
* Readme: added Windows usage remarks
* Add `bower.json` to properly support bower install
2.1.0 / 2014-10-15
==================
* node: implement `DEBUG_FD` env variable support
* package: update "browserify" to v6.1.0
* package: add "license" field to package.json (#135, @panuhorsmalahti)
2.0.0 / 2014-09-01
==================
* package: update "browserify" to v5.11.0
* node: use stderr rather than stdout for logging (#29, @stephenmathieson)
1.0.4 / 2014-07-15
==================
* dist: recompile
* example: remove `console.info()` log usage
* example: add "Content-Type" UTF-8 header to browser example
* browser: place %c marker after the space character
* browser: reset the "content" color via `color: inherit`
* browser: add colors support for Firefox >= v31
* debug: prefer an instance `log()` function over the global one (#119)
* Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
1.0.3 / 2014-07-09
==================
* Add support for multiple wildcards in namespaces (#122, @seegno)
* browser: fix lint
1.0.2 / 2014-06-10
==================
* browser: update color palette (#113, @gscottolson)
* common: make console logging function configurable (#108, @timoxley)
* node: fix %o colors on old node <= 0.8.x
* Makefile: find node path using shell/which (#109, @timoxley)
1.0.1 / 2014-06-06
==================
* browser: use `removeItem()` to clear localStorage
* browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
* package: add "contributors" section
* node: fix comment typo
* README: list authors
1.0.0 / 2014-06-04
==================
* make ms diff be global, not be scope
* debug: ignore empty strings in enable()
* node: make DEBUG_COLORS able to disable coloring
* *: export the `colors` array
* npmignore: don't publish the `dist` dir
* Makefile: refactor to use browserify
* package: add "browserify" as a dev dependency
* Readme: add Web Inspector Colors section
* node: reset terminal color for the debug content
* node: map "%o" to `util.inspect()`
* browser: map "%j" to `JSON.stringify()`
* debug: add custom "formatters"
* debug: use "ms" module for humanizing the diff
* Readme: add "bash" syntax highlighting
* browser: add Firebug color support
* browser: add colors for WebKit browsers
* node: apply log to `console`
* rewrite: abstract common logic for Node & browsers
* add .jshintrc file
0.8.1 / 2014-04-14
==================
* package: re-add the "component" section
0.8.0 / 2014-03-30
==================
* add `enable()` method for nodejs. Closes #27
* change from stderr to stdout
* remove unnecessary index.js file
0.7.4 / 2013-11-13
==================
* remove "browserify" key from package.json (fixes something in browserify)
0.7.3 / 2013-10-30
==================
* fix: catch localStorage security error when cookies are blocked (Chrome)
* add debug(err) support. Closes #46
* add .browser prop to package.json. Closes #42
0.7.2 / 2013-02-06
==================
* fix package.json
* fix: Mobile Safari (private mode) is broken with debug
* fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
0.7.1 / 2013-02-05
==================
* add repository URL to package.json
* add DEBUG_COLORED to force colored output
* add browserify support
* fix component. Closes #24
0.7.0 / 2012-05-04
==================
* Added .component to package.json
* Added debug.component.js build
0.6.0 / 2012-03-16
==================
* Added support for "-" prefix in DEBUG [Vinay Pulim]
* Added `.enabled` flag to the node version [TooTallNate]
0.5.0 / 2012-02-02
==================
* Added: humanize diffs. Closes #8
* Added `debug.disable()` to the CS variant
* Removed padding. Closes #10
* Fixed: persist client-side variant again. Closes #9
0.4.0 / 2012-02-01
==================
* Added browser variant support for older browsers [TooTallNate]
* Added `debug.enable('project:*')` to browser variant [TooTallNate]
* Added padding to diff (moved it to the right)
0.3.0 / 2012-01-26
==================
* Added millisecond diff when isatty, otherwise UTC string
0.2.0 / 2012-01-22
==================
* Added wildcard support
0.1.0 / 2011-12-02
==================
* Added: remove colors unless stderr isatty [TooTallNate]
0.0.1 / 2010-01-03
==================
* Initial release

View file

@ -0,0 +1,19 @@
(The MIT License)
Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca>
Permission is hereby granted, free of charge, to any person obtaining a copy of this software
and associated documentation files (the 'Software'), to deal in the Software without restriction,
including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense,
and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
subject to the following conditions:
The above copyright notice and this permission notice shall be included in all copies or substantial
portions of the Software.
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT
LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

View file

@ -0,0 +1,437 @@
# debug
[![Build Status](https://travis-ci.org/visionmedia/debug.svg?branch=master)](https://travis-ci.org/visionmedia/debug) [![Coverage Status](https://coveralls.io/repos/github/visionmedia/debug/badge.svg?branch=master)](https://coveralls.io/github/visionmedia/debug?branch=master) [![Slack](https://visionmedia-community-slackin.now.sh/badge.svg)](https://visionmedia-community-slackin.now.sh/) [![OpenCollective](https://opencollective.com/debug/backers/badge.svg)](#backers)
[![OpenCollective](https://opencollective.com/debug/sponsors/badge.svg)](#sponsors)
<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
A tiny JavaScript debugging utility modelled after Node.js core's debugging
technique. Works in Node.js and web browsers.
## Installation
```bash
$ npm install debug
```
## Usage
`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
Example [_app.js_](./examples/node/app.js):
```js
var debug = require('debug')('http')
, http = require('http')
, name = 'My App';
// fake app
debug('booting %o', name);
http.createServer(function(req, res){
debug(req.method + ' ' + req.url);
res.end('hello\n');
}).listen(3000, function(){
debug('listening');
});
// fake worker of some kind
require('./worker');
```
Example [_worker.js_](./examples/node/worker.js):
```js
var a = require('debug')('worker:a')
, b = require('debug')('worker:b');
function work() {
a('doing lots of uninteresting work');
setTimeout(work, Math.random() * 1000);
}
work();
function workb() {
b('doing some work');
setTimeout(workb, Math.random() * 2000);
}
workb();
```
The `DEBUG` environment variable is then used to enable these based on space or
comma-delimited names.
Here are some examples:
<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png">
<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png">
<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png">
#### Windows command prompt notes
##### CMD
On Windows the environment variable is set using the `set` command.
```cmd
set DEBUG=*,-not_this
```
Example:
```cmd
set DEBUG=* & node app.js
```
##### PowerShell (VS Code default)
PowerShell uses different syntax to set environment variables.
```cmd
$env:DEBUG = "*,-not_this"
```
Example:
```cmd
$env:DEBUG='app';node app.js
```
Then, run the program to be debugged as usual.
npm script example:
```js
"windowsDebug": "@powershell -Command $env:DEBUG='*';node app.js",
```
## Namespace Colors
Every debug instance has a color generated for it based on its namespace name.
This helps when visually parsing the debug output to identify which debug instance
a debug line belongs to.
#### Node.js
In Node.js, colors are enabled when stderr is a TTY. You also _should_ install
the [`supports-color`](https://npmjs.org/supports-color) module alongside debug,
otherwise debug will only use a small handful of basic colors.
<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png">
#### Web Browser
Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
option. These are WebKit web inspectors, Firefox ([since version
31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
and the Firebug plugin for Firefox (any version).
<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png">
## Millisecond diff
When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png">
When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below:
<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png">
## Conventions
If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output.
## Wildcards
The `*` character may be used as a wildcard. Suppose for example your library has
debuggers named "connect:bodyParser", "connect:compress", "connect:session",
instead of listing all three with
`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do
`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
You can also exclude specific debuggers by prefixing them with a "-" character.
For example, `DEBUG=*,-connect:*` would include all debuggers except those
starting with "connect:".
## Environment Variables
When running through Node.js, you can set a few environment variables that will
change the behavior of the debug logging:
| Name | Purpose |
|-----------|-------------------------------------------------|
| `DEBUG` | Enables/disables specific debugging namespaces. |
| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). |
| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
| `DEBUG_DEPTH` | Object inspection depth. |
| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
__Note:__ The environment variables beginning with `DEBUG_` end up being
converted into an Options object that gets used with `%o`/`%O` formatters.
See the Node.js documentation for
[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
for the complete list.
## Formatters
Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting.
Below are the officially supported formatters:
| Formatter | Representation |
|-----------|----------------|
| `%O` | Pretty-print an Object on multiple lines. |
| `%o` | Pretty-print an Object all on a single line. |
| `%s` | String. |
| `%d` | Number (both integer and float). |
| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
| `%%` | Single percent sign ('%'). This does not consume an argument. |
### Custom formatters
You can add custom formatters by extending the `debug.formatters` object.
For example, if you wanted to add support for rendering a Buffer as hex with
`%h`, you could do something like:
```js
const createDebug = require('debug')
createDebug.formatters.h = (v) => {
return v.toString('hex')
}
// …elsewhere
const debug = createDebug('foo')
debug('this is hex: %h', new Buffer('hello world'))
// foo this is hex: 68656c6c6f20776f726c6421 +0ms
```
## Browser Support
You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
if you don't want to build it yourself.
Debug's enable state is currently persisted by `localStorage`.
Consider the situation shown below where you have `worker:a` and `worker:b`,
and wish to debug both. You can enable this using `localStorage.debug`:
```js
localStorage.debug = 'worker:*'
```
And then refresh the page.
```js
a = debug('worker:a');
b = debug('worker:b');
setInterval(function(){
a('doing some work');
}, 1000);
setInterval(function(){
b('doing some work');
}, 1200);
```
## Output streams
By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
Example [_stdout.js_](./examples/node/stdout.js):
```js
var debug = require('debug');
var error = debug('app:error');
// by default stderr is used
error('goes to stderr!');
var log = debug('app:log');
// set this namespace to log via console.log
log.log = console.log.bind(console); // don't forget to bind to console!
log('goes to stdout');
error('still goes to stderr!');
// set all output to go via console.info
// overrides all per-namespace log settings
debug.log = console.info.bind(console);
error('now goes to stdout via console.info');
log('still goes to stdout, but via console.info now');
```
## Extend
You can simply extend debugger
```js
const log = require('debug')('auth');
//creates new debug instance with extended namespace
const logSign = log.extend('sign');
const logLogin = log.extend('login');
log('hello'); // auth hello
logSign('hello'); //auth:sign hello
logLogin('hello'); //auth:login hello
```
## Set dynamically
You can also enable debug dynamically by calling the `enable()` method :
```js
let debug = require('debug');
console.log(1, debug.enabled('test'));
debug.enable('test');
console.log(2, debug.enabled('test'));
debug.disable();
console.log(3, debug.enabled('test'));
```
print :
```
1 false
2 true
3 false
```
Usage :
`enable(namespaces)`
`namespaces` can include modes separated by a colon and wildcards.
Note that calling `enable()` completely overrides previously set DEBUG variable :
```
$ DEBUG=foo node -e 'var dbg = require("debug"); dbg.enable("bar"); console.log(dbg.enabled("foo"))'
=> false
```
## Checking whether a debug target is enabled
After you've created a debug instance, you can determine whether or not it is
enabled by checking the `enabled` property:
```javascript
const debug = require('debug')('http');
if (debug.enabled) {
// do stuff...
}
```
You can also manually toggle this property to force the debug instance to be
enabled or disabled.
## Authors
- TJ Holowaychuk
- Nathan Rajlich
- Andrew Rhyne
## Backers
Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a>
<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a>
## Sponsors
Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)]
<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a>
<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a>
## License
(The MIT License)
Copyright (c) 2014-2017 TJ Holowaychuk &lt;tj@vision-media.ca&gt;
Permission is hereby granted, free of charge, to any person obtaining
a copy of this software and associated documentation files (the
'Software'), to deal in the Software without restriction, including
without limitation the rights to use, copy, modify, merge, publish,
distribute, sublicense, and/or sell copies of the Software, and to
permit persons to whom the Software is furnished to do so, subject to
the following conditions:
The above copyright notice and this permission notice shall be
included in all copies or substantial portions of the Software.
THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

View file

@ -0,0 +1 @@
module.exports = require('./src/node');

View file

@ -0,0 +1,51 @@
{
"name": "debug",
"version": "3.2.7",
"repository": {
"type": "git",
"url": "git://github.com/visionmedia/debug.git"
},
"description": "small debugging utility",
"keywords": [
"debug",
"log",
"debugger"
],
"files": [
"src",
"node.js",
"dist/debug.js",
"LICENSE",
"README.md"
],
"author": "TJ Holowaychuk <tj@vision-media.ca>",
"contributors": [
"Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)",
"Andrew Rhyne <rhyneandrew@gmail.com>"
],
"license": "MIT",
"dependencies": {
"ms": "^2.1.1"
},
"devDependencies": {
"@babel/cli": "^7.0.0",
"@babel/core": "^7.0.0",
"@babel/preset-env": "^7.0.0",
"browserify": "14.4.0",
"chai": "^3.5.0",
"concurrently": "^3.1.0",
"coveralls": "^3.0.2",
"istanbul": "^0.4.5",
"karma": "^3.0.0",
"karma-chai": "^0.1.0",
"karma-mocha": "^1.3.0",
"karma-phantomjs-launcher": "^1.0.2",
"mocha": "^5.2.0",
"mocha-lcov-reporter": "^1.2.0",
"rimraf": "^2.5.4",
"xo": "^0.23.0"
},
"main": "./src/index.js",
"browser": "./src/browser.js",
"unpkg": "./dist/debug.js"
}

View file

@ -0,0 +1,180 @@
"use strict";
function _typeof(obj) { if (typeof Symbol === "function" && typeof Symbol.iterator === "symbol") { _typeof = function _typeof(obj) { return typeof obj; }; } else { _typeof = function _typeof(obj) { return obj && typeof Symbol === "function" && obj.constructor === Symbol && obj !== Symbol.prototype ? "symbol" : typeof obj; }; } return _typeof(obj); }
/* eslint-env browser */
/**
* This is the web browser implementation of `debug()`.
*/
exports.log = log;
exports.formatArgs = formatArgs;
exports.save = save;
exports.load = load;
exports.useColors = useColors;
exports.storage = localstorage();
/**
* Colors.
*/
exports.colors = ['#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33'];
/**
* Currently only WebKit-based Web Inspectors, Firefox >= v31,
* and the Firebug extension (any Firefox version) are known
* to support "%c" CSS customizations.
*
* TODO: add a `localStorage` variable to explicitly enable/disable colors
*/
// eslint-disable-next-line complexity
function useColors() {
// NB: In an Electron preload script, document will be defined but not fully
// initialized. Since we know we're in Chrome, we'll just detect this case
// explicitly
if (typeof window !== 'undefined' && window.process && (window.process.type === 'renderer' || window.process.__nwjs)) {
return true;
} // Internet Explorer and Edge do not support colors.
if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) {
return false;
} // Is webkit? http://stackoverflow.com/a/16459606/376773
// document is undefined in react-native: https://github.com/facebook/react-native/pull/1632
return typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance || // Is firebug? http://stackoverflow.com/a/398120/376773
typeof window !== 'undefined' && window.console && (window.console.firebug || window.console.exception && window.console.table) || // Is firefox >= v31?
// https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31 || // Double check webkit in userAgent just in case we are in a worker
typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/);
}
/**
* Colorize log arguments if enabled.
*
* @api public
*/
function formatArgs(args) {
args[0] = (this.useColors ? '%c' : '') + this.namespace + (this.useColors ? ' %c' : ' ') + args[0] + (this.useColors ? '%c ' : ' ') + '+' + module.exports.humanize(this.diff);
if (!this.useColors) {
return;
}
var c = 'color: ' + this.color;
args.splice(1, 0, c, 'color: inherit'); // The final "%c" is somewhat tricky, because there could be other
// arguments passed either before or after the %c, so we need to
// figure out the correct index to insert the CSS into
var index = 0;
var lastC = 0;
args[0].replace(/%[a-zA-Z%]/g, function (match) {
if (match === '%%') {
return;
}
index++;
if (match === '%c') {
// We only are interested in the *last* %c
// (the user may have provided their own)
lastC = index;
}
});
args.splice(lastC, 0, c);
}
/**
* Invokes `console.log()` when available.
* No-op when `console.log` is not a "function".
*
* @api public
*/
function log() {
var _console;
// This hackery is required for IE8/9, where
// the `console.log` function doesn't have 'apply'
return (typeof console === "undefined" ? "undefined" : _typeof(console)) === 'object' && console.log && (_console = console).log.apply(_console, arguments);
}
/**
* Save `namespaces`.
*
* @param {String} namespaces
* @api private
*/
function save(namespaces) {
try {
if (namespaces) {
exports.storage.setItem('debug', namespaces);
} else {
exports.storage.removeItem('debug');
}
} catch (error) {// Swallow
// XXX (@Qix-) should we be logging these?
}
}
/**
* Load `namespaces`.
*
* @return {String} returns the previously persisted debug modes
* @api private
*/
function load() {
var r;
try {
r = exports.storage.getItem('debug');
} catch (error) {} // Swallow
// XXX (@Qix-) should we be logging these?
// If debug isn't set in LS, and we're in Electron, try to load $DEBUG
if (!r && typeof process !== 'undefined' && 'env' in process) {
r = process.env.DEBUG;
}
return r;
}
/**
* Localstorage attempts to return the localstorage.
*
* This is necessary because safari throws
* when a user disables cookies/localstorage
* and you attempt to access it.
*
* @return {LocalStorage}
* @api private
*/
function localstorage() {
try {
// TVMLKit (Apple TV JS Runtime) does not have a window object, just localStorage in the global context
// The Browser also has localStorage in the global context.
return localStorage;
} catch (error) {// Swallow
// XXX (@Qix-) should we be logging these?
}
}
module.exports = require('./common')(exports);
var formatters = module.exports.formatters;
/**
* Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
*/
formatters.j = function (v) {
try {
return JSON.stringify(v);
} catch (error) {
return '[UnexpectedJSONParseError]: ' + error.message;
}
};

View file

@ -0,0 +1,249 @@
"use strict";
/**
* This is the common logic for both the Node.js and web browser
* implementations of `debug()`.
*/
function setup(env) {
createDebug.debug = createDebug;
createDebug.default = createDebug;
createDebug.coerce = coerce;
createDebug.disable = disable;
createDebug.enable = enable;
createDebug.enabled = enabled;
createDebug.humanize = require('ms');
Object.keys(env).forEach(function (key) {
createDebug[key] = env[key];
});
/**
* Active `debug` instances.
*/
createDebug.instances = [];
/**
* The currently active debug mode names, and names to skip.
*/
createDebug.names = [];
createDebug.skips = [];
/**
* Map of special "%n" handling functions, for the debug "format" argument.
*
* Valid key names are a single, lower or upper-case letter, i.e. "n" and "N".
*/
createDebug.formatters = {};
/**
* Selects a color for a debug namespace
* @param {String} namespace The namespace string for the for the debug instance to be colored
* @return {Number|String} An ANSI color code for the given namespace
* @api private
*/
function selectColor(namespace) {
var hash = 0;
for (var i = 0; i < namespace.length; i++) {
hash = (hash << 5) - hash + namespace.charCodeAt(i);
hash |= 0; // Convert to 32bit integer
}
return createDebug.colors[Math.abs(hash) % createDebug.colors.length];
}
createDebug.selectColor = selectColor;
/**
* Create a debugger with the given `namespace`.
*
* @param {String} namespace
* @return {Function}
* @api public
*/
function createDebug(namespace) {
var prevTime;
function debug() {
// Disabled?
if (!debug.enabled) {
return;
}
for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
args[_key] = arguments[_key];
}
var self = debug; // Set `diff` timestamp
var curr = Number(new Date());
var ms = curr - (prevTime || curr);
self.diff = ms;
self.prev = prevTime;
self.curr = curr;
prevTime = curr;
args[0] = createDebug.coerce(args[0]);
if (typeof args[0] !== 'string') {
// Anything else let's inspect with %O
args.unshift('%O');
} // Apply any `formatters` transformations
var index = 0;
args[0] = args[0].replace(/%([a-zA-Z%])/g, function (match, format) {
// If we encounter an escaped % then don't increase the array index
if (match === '%%') {
return match;
}
index++;
var formatter = createDebug.formatters[format];
if (typeof formatter === 'function') {
var val = args[index];
match = formatter.call(self, val); // Now we need to remove `args[index]` since it's inlined in the `format`
args.splice(index, 1);
index--;
}
return match;
}); // Apply env-specific formatting (colors, etc.)
createDebug.formatArgs.call(self, args);
var logFn = self.log || createDebug.log;
logFn.apply(self, args);
}
debug.namespace = namespace;
debug.enabled = createDebug.enabled(namespace);
debug.useColors = createDebug.useColors();
debug.color = selectColor(namespace);
debug.destroy = destroy;
debug.extend = extend; // Debug.formatArgs = formatArgs;
// debug.rawLog = rawLog;
// env-specific initialization logic for debug instances
if (typeof createDebug.init === 'function') {
createDebug.init(debug);
}
createDebug.instances.push(debug);
return debug;
}
function destroy() {
var index = createDebug.instances.indexOf(this);
if (index !== -1) {
createDebug.instances.splice(index, 1);
return true;
}
return false;
}
function extend(namespace, delimiter) {
return createDebug(this.namespace + (typeof delimiter === 'undefined' ? ':' : delimiter) + namespace);
}
/**
* Enables a debug mode by namespaces. This can include modes
* separated by a colon and wildcards.
*
* @param {String} namespaces
* @api public
*/
function enable(namespaces) {
createDebug.save(namespaces);
createDebug.names = [];
createDebug.skips = [];
var i;
var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/);
var len = split.length;
for (i = 0; i < len; i++) {
if (!split[i]) {
// ignore empty strings
continue;
}
namespaces = split[i].replace(/\*/g, '.*?');
if (namespaces[0] === '-') {
createDebug.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
} else {
createDebug.names.push(new RegExp('^' + namespaces + '$'));
}
}
for (i = 0; i < createDebug.instances.length; i++) {
var instance = createDebug.instances[i];
instance.enabled = createDebug.enabled(instance.namespace);
}
}
/**
* Disable debug output.
*
* @api public
*/
function disable() {
createDebug.enable('');
}
/**
* Returns true if the given mode name is enabled, false otherwise.
*
* @param {String} name
* @return {Boolean}
* @api public
*/
function enabled(name) {
if (name[name.length - 1] === '*') {
return true;
}
var i;
var len;
for (i = 0, len = createDebug.skips.length; i < len; i++) {
if (createDebug.skips[i].test(name)) {
return false;
}
}
for (i = 0, len = createDebug.names.length; i < len; i++) {
if (createDebug.names[i].test(name)) {
return true;
}
}
return false;
}
/**
* Coerce `val`.
*
* @param {Mixed} val
* @return {Mixed}
* @api private
*/
function coerce(val) {
if (val instanceof Error) {
return val.stack || val.message;
}
return val;
}
createDebug.enable(createDebug.load());
return createDebug;
}
module.exports = setup;

View file

@ -0,0 +1,12 @@
"use strict";
/**
* Detect Electron renderer / nwjs process, which is node, but we should
* treat as a browser.
*/
if (typeof process === 'undefined' || process.type === 'renderer' || process.browser === true || process.__nwjs) {
module.exports = require('./browser.js');
} else {
module.exports = require('./node.js');
}

View file

@ -0,0 +1,177 @@
"use strict";
/**
* Module dependencies.
*/
var tty = require('tty');
var util = require('util');
/**
* This is the Node.js implementation of `debug()`.
*/
exports.init = init;
exports.log = log;
exports.formatArgs = formatArgs;
exports.save = save;
exports.load = load;
exports.useColors = useColors;
/**
* Colors.
*/
exports.colors = [6, 2, 3, 4, 5, 1];
try {
// Optional dependency (as in, doesn't need to be installed, NOT like optionalDependencies in package.json)
// eslint-disable-next-line import/no-extraneous-dependencies
var supportsColor = require('supports-color');
if (supportsColor && (supportsColor.stderr || supportsColor).level >= 2) {
exports.colors = [20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68, 69, 74, 75, 76, 77, 78, 79, 80, 81, 92, 93, 98, 99, 112, 113, 128, 129, 134, 135, 148, 149, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, 172, 173, 178, 179, 184, 185, 196, 197, 198, 199, 200, 201, 202, 203, 204, 205, 206, 207, 208, 209, 214, 215, 220, 221];
}
} catch (error) {} // Swallow - we only care if `supports-color` is available; it doesn't have to be.
/**
* Build up the default `inspectOpts` object from the environment variables.
*
* $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js
*/
exports.inspectOpts = Object.keys(process.env).filter(function (key) {
return /^debug_/i.test(key);
}).reduce(function (obj, key) {
// Camel-case
var prop = key.substring(6).toLowerCase().replace(/_([a-z])/g, function (_, k) {
return k.toUpperCase();
}); // Coerce string value into JS value
var val = process.env[key];
if (/^(yes|on|true|enabled)$/i.test(val)) {
val = true;
} else if (/^(no|off|false|disabled)$/i.test(val)) {
val = false;
} else if (val === 'null') {
val = null;
} else {
val = Number(val);
}
obj[prop] = val;
return obj;
}, {});
/**
* Is stdout a TTY? Colored output is enabled when `true`.
*/
function useColors() {
return 'colors' in exports.inspectOpts ? Boolean(exports.inspectOpts.colors) : tty.isatty(process.stderr.fd);
}
/**
* Adds ANSI color escape codes if enabled.
*
* @api public
*/
function formatArgs(args) {
var name = this.namespace,
useColors = this.useColors;
if (useColors) {
var c = this.color;
var colorCode = "\x1B[3" + (c < 8 ? c : '8;5;' + c);
var prefix = " ".concat(colorCode, ";1m").concat(name, " \x1B[0m");
args[0] = prefix + args[0].split('\n').join('\n' + prefix);
args.push(colorCode + 'm+' + module.exports.humanize(this.diff) + "\x1B[0m");
} else {
args[0] = getDate() + name + ' ' + args[0];
}
}
function getDate() {
if (exports.inspectOpts.hideDate) {
return '';
}
return new Date().toISOString() + ' ';
}
/**
* Invokes `util.format()` with the specified arguments and writes to stderr.
*/
function log() {
return process.stderr.write(util.format.apply(util, arguments) + '\n');
}
/**
* Save `namespaces`.
*
* @param {String} namespaces
* @api private
*/
function save(namespaces) {
if (namespaces) {
process.env.DEBUG = namespaces;
} else {
// If you set a process.env field to null or undefined, it gets cast to the
// string 'null' or 'undefined'. Just delete instead.
delete process.env.DEBUG;
}
}
/**
* Load `namespaces`.
*
* @return {String} returns the previously persisted debug modes
* @api private
*/
function load() {
return process.env.DEBUG;
}
/**
* Init logic for `debug` instances.
*
* Create a new `inspectOpts` object in case `useColors` is set
* differently for a particular `debug` instance.
*/
function init(debug) {
debug.inspectOpts = {};
var keys = Object.keys(exports.inspectOpts);
for (var i = 0; i < keys.length; i++) {
debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]];
}
}
module.exports = require('./common')(exports);
var formatters = module.exports.formatters;
/**
* Map %o to `util.inspect()`, all on a single line.
*/
formatters.o = function (v) {
this.inspectOpts.colors = this.useColors;
return util.inspect(v, this.inspectOpts)
.split('\n')
.map(function (str) { return str.trim(); })
.join(' ');
};
/**
* Map %O to `util.inspect()`, allowing multiple lines if needed.
*/
formatters.O = function (v) {
this.inspectOpts.colors = this.useColors;
return util.inspect(v, this.inspectOpts);
};

42
Frontend-Learner/node_modules/koa-static/package.json generated vendored Normal file
View file

@ -0,0 +1,42 @@
{
"name": "koa-static",
"description": "Static file serving middleware for koa",
"repository": "koajs/static",
"version": "5.0.0",
"keywords": [
"koa",
"middleware",
"file",
"static",
"sendfile"
],
"files": [
"index.js"
],
"devDependencies": {
"eslint": "^4.19.1",
"eslint-config-standard": "^11.0.0",
"eslint-plugin-import": "^2.12.0",
"eslint-plugin-node": "^6.0.1",
"eslint-plugin-promise": "^3.8.0",
"eslint-plugin-standard": "^3.1.0",
"istanbul": "^0.4.5",
"koa": "^2.5.1",
"mocha": "^5.2.0",
"supertest": "^3.1.0"
},
"license": "MIT",
"dependencies": {
"debug": "^3.1.0",
"koa-send": "^5.0.0"
},
"scripts": {
"lint": "eslint --fix .",
"test": "mocha --harmony --reporter spec --exit",
"test-cov": "node --harmony ./node_modules/.bin/istanbul cover ./node_modules/.bin/_mocha -- --exit",
"test-travis": "node --harmony ./node_modules/.bin/istanbul cover ./node_modules/.bin/_mocha --report lcovonly -- --exit"
},
"engines": {
"node": ">= 7.6.0"
}
}